C9H14N2O4S — CID 167081500
N-(ethylaminomethyl)-5-methylsulfonylfuran-2-carboxamide (PubChem CID 167081500) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is N-(ethylaminomethyl)-5-methylsulfonylfuran-2-carboxamide.
| Compound Name | N-(ethylaminomethyl)-5-methylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 167081500 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-(ethylaminomethyl)-5-methylsulfonylfuran-2-carboxamide |
| SMILES | CCNCNC(=O)c1ccc(S(C)(=O)=O)o1 |
| InChI | InChI=1S/C9H14N2O4S/c1-3-10-6-11-9(12)7-4-5-8(15-7)16(2,13)14/h4-5,10H,3,6H2,1-2H3,(H,11,12) |
| InChIKey | KCKPHZIFPSDYEP-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|