C20H17FN2O5S — CID 86944356
N-[4-[(2-fluorophenyl)methylcarbamoyl]phenyl]-5-methylsulfonylfuran-2-carboxamide (PubChem CID 86944356) has the molecular formula C20H17FN2O5S and a molecular weight of 416.43 g/mol. Its IUPAC name is N-[4-[(2-fluorophenyl)methylcarbamoyl]phenyl]-5-methylsulfonylfuran-2-carboxamide.
| Compound Name | N-[4-[(2-fluorophenyl)methylcarbamoyl]phenyl]-5-methylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 86944356 |
| Molecular Formula | C20H17FN2O5S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | N-[4-[(2-fluorophenyl)methylcarbamoyl]phenyl]-5-methylsulfonylfuran-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2ccc(C(=O)NCc3ccccc3F)cc2)o1 |
| InChI | InChI=1S/C20H17FN2O5S/c1-29(26,27)18-11-10-17(28-18)20(25)23-15-8-6-13(7-9-15)19(24)22-12-14-4-2-3-5-16(14)21/h2-11H,12H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | CBEHCJUZGYRMOT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |