C9H13NO4S2 — CID 86944148
N-(2-methylsulfanylethyl)-5-methylsulfonylfuran-2-carboxamide (PubChem CID 86944148) has the molecular formula C9H13NO4S2 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-(2-methylsulfanylethyl)-5-methylsulfonylfuran-2-carboxamide.
| Compound Name | N-(2-methylsulfanylethyl)-5-methylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 86944148 |
| Molecular Formula | C9H13NO4S2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | N-(2-methylsulfanylethyl)-5-methylsulfonylfuran-2-carboxamide |
| SMILES | CSCCNC(=O)c1ccc(S(C)(=O)=O)o1 |
| InChI | InChI=1S/C9H13NO4S2/c1-15-6-5-10-9(11)7-3-4-8(14-7)16(2,12)13/h3-4H,5-6H2,1-2H3,(H,10,11) |
| InChIKey | CYRVWYLOOBQCPX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|