C9H11F3N2O4S — CID 112527770
5-(methylsulfamoyl)-N-(3,3,3-trifluoropropyl)furan-2-carboxamide (PubChem CID 112527770) has the molecular formula C9H11F3N2O4S and a molecular weight of 300.26 g/mol. Its IUPAC name is 5-(methylsulfamoyl)-N-(3,3,3-trifluoropropyl)furan-2-carboxamide.
| Compound Name | 5-(methylsulfamoyl)-N-(3,3,3-trifluoropropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 112527770 |
| Molecular Formula | C9H11F3N2O4S |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 5-(methylsulfamoyl)-N-(3,3,3-trifluoropropyl)furan-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)NCCC(F)(F)F)o1 |
| InChI | InChI=1S/C9H11F3N2O4S/c1-13-19(16,17)7-3-2-6(18-7)8(15)14-5-4-9(10,11)12/h2-3,13H,4-5H2,1H3,(H,14,15) |
| InChIKey | IBTLKAGACOMYKD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |