C16H18N2O7S — CID 119255846
2-[4-[2-[[5-(methylsulfamoyl)furan-2-carbonyl]amino]ethyl]phenoxy]acetic acid (PubChem CID 119255846) has the molecular formula C16H18N2O7S and a molecular weight of 382.39 g/mol. Its IUPAC name is 2-[4-[2-[[5-(methylsulfamoyl)furan-2-carbonyl]amino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[[5-(methylsulfamoyl)furan-2-carbonyl]amino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119255846 |
| Molecular Formula | C16H18N2O7S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-[4-[2-[[5-(methylsulfamoyl)furan-2-carbonyl]amino]ethyl]phenoxy]acetic acid |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)NCCc2ccc(OCC(=O)O)cc2)o1 |
| InChI | InChI=1S/C16H18N2O7S/c1-17-26(22,23)15-7-6-13(25-15)16(21)18-9-8-11-2-4-12(5-3-11)24-10-14(19)20/h2-7,17H,8-10H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | SEXRJOMYJSEJAZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |