C19H23NO5 — CID 120688153
2-[4-[2-[(4,5-diethylfuran-2-carbonyl)amino]ethyl]phenoxy]acetic acid (PubChem CID 120688153) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[4-[2-[(4,5-diethylfuran-2-carbonyl)amino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[(4,5-diethylfuran-2-carbonyl)amino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 120688153 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-[4-[2-[(4,5-diethylfuran-2-carbonyl)amino]ethyl]phenoxy]acetic acid |
| SMILES | CCc1cc(C(=O)NCCc2ccc(OCC(=O)O)cc2)oc1CC |
| InChI | InChI=1S/C19H23NO5/c1-3-14-11-17(25-16(14)4-2)19(23)20-10-9-13-5-7-15(8-6-13)24-12-18(21)22/h5-8,11H,3-4,9-10,12H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | SUVRSRAVKSJTGB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |