2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid

C17H25NO4 — CID 120529051

IUPAC2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid
SMILESCCC(C)C(C)C(=O)NCCc1ccc(OCC(=O)O)cc1
InChIInChI=1S/C17H25NO4/c1-4-12(2)13(3)17(21)18-10-9-14-5-7-15(8-6-14)22-11-16(19)20/h5-8,12-13H,4,9-11H2,1-3H3,(H,18,21)(H,19,20)
InChIKeyGIRNZJXLXCVFRC-UHFFFAOYSA-N
MW307.39 g/mol
LogP2.49
Rot. Bonds9

About 2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid

2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid (PubChem CID 120529051) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid.

Molecular Properties

Compound Name2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid
PubChem CID120529051
Molecular FormulaC17H25NO4
Molecular Weight307.39 g/mol
Exact Mass307.18
IUPAC Name2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid
SMILESCCC(C)C(C)C(=O)NCCc1ccc(OCC(=O)O)cc1
InChIInChI=1S/C17H25NO4/c1-4-12(2)13(3)17(21)18-10-9-14-5-7-15(8-6-14)22-11-16(19)20/h5-8,12-13H,4,9-11H2,1-3H3,(H,18,21)(H,19,20)
InChIKeyGIRNZJXLXCVFRC-UHFFFAOYSA-N
XLogP2.49
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.39
LogP ≤ 52.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid?
The IUPAC name of 2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid (CID 120529051) is 2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid.
What is the SMILES notation for 2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid?
The canonical SMILES for 2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid is CCC(C)C(C)C(=O)NCCc1ccc(OCC(=O)O)cc1.
What is the InChIKey of 2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid?
The InChIKey is GIRNZJXLXCVFRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO4/c1-4-12(2)13(3)17(21)18-10-9-14-5-7-15(8-6-14)22-11-16(19)20/h5-8,12-13H,4,9-11H2,1-3H3,(H,18,21)(H,19,20).
What are the key properties of 2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid?
2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid has a molecular weight of 307.39 g/mol, XLogP of 2.49, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(2,3-dimethylpentanoylamino)ethyl]phenoxy]acetic acid is sourced from PubChem (CID 120529051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).