C19H27NO4 — CID 119255457
2-[4-[2-[(3-cyclopentyl-2-methylpropanoyl)amino]ethyl]phenoxy]acetic acid (PubChem CID 119255457) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-[4-[2-[(3-cyclopentyl-2-methylpropanoyl)amino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[(3-cyclopentyl-2-methylpropanoyl)amino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119255457 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 2-[4-[2-[(3-cyclopentyl-2-methylpropanoyl)amino]ethyl]phenoxy]acetic acid |
| SMILES | CC(CC1CCCC1)C(=O)NCCc1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C19H27NO4/c1-14(12-16-4-2-3-5-16)19(23)20-11-10-15-6-8-17(9-7-15)24-13-18(21)22/h6-9,14,16H,2-5,10-13H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | AZHPYFOMWVFMQO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |