C18H20N2O6 — CID 119255513
2-[4-[2-[2-(furan-3-carbonylamino)propanoylamino]ethyl]phenoxy]acetic acid (PubChem CID 119255513) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-[4-[2-[2-(furan-3-carbonylamino)propanoylamino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[2-(furan-3-carbonylamino)propanoylamino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119255513 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-[4-[2-[2-(furan-3-carbonylamino)propanoylamino]ethyl]phenoxy]acetic acid |
| SMILES | CC(NC(=O)c1ccoc1)C(=O)NCCc1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C18H20N2O6/c1-12(20-18(24)14-7-9-25-10-14)17(23)19-8-6-13-2-4-15(5-3-13)26-11-16(21)22/h2-5,7,9-10,12H,6,8,11H2,1H3,(H,19,23)(H,20,24)(H,21,22) |
| InChIKey | UQGGUEGDVGDNRY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |