C10H11ClF3NO2 — CID 103839345
5-chloro-N-(5,5,5-trifluoropentyl)furan-2-carboxamide (PubChem CID 103839345) has the molecular formula C10H11ClF3NO2 and a molecular weight of 269.65 g/mol. Its IUPAC name is 5-chloro-N-(5,5,5-trifluoropentyl)furan-2-carboxamide.
| Compound Name | 5-chloro-N-(5,5,5-trifluoropentyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 103839345 |
| Molecular Formula | C10H11ClF3NO2 |
| Molecular Weight | 269.65 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 5-chloro-N-(5,5,5-trifluoropentyl)furan-2-carboxamide |
| SMILES | O=C(NCCCCC(F)(F)F)c1ccc(Cl)o1 |
| InChI | InChI=1S/C10H11ClF3NO2/c11-8-4-3-7(17-8)9(16)15-6-2-1-5-10(12,13)14/h3-4H,1-2,5-6H2,(H,15,16) |
| InChIKey | CPAPEUWYBVFKLS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.65 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|