C9H10ClNO5 — CID 79468837
2-[2-[(5-chlorofuran-2-carbonyl)amino]ethoxy]acetic acid (PubChem CID 79468837) has the molecular formula C9H10ClNO5 and a molecular weight of 247.63 g/mol. Its IUPAC name is 2-[2-[(5-chlorofuran-2-carbonyl)amino]ethoxy]acetic acid.
| Compound Name | 2-[2-[(5-chlorofuran-2-carbonyl)amino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 79468837 |
| Molecular Formula | C9H10ClNO5 |
| Molecular Weight | 247.63 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 2-[2-[(5-chlorofuran-2-carbonyl)amino]ethoxy]acetic acid |
| SMILES | O=C(O)COCCNC(=O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C9H10ClNO5/c10-7-2-1-6(16-7)9(14)11-3-4-15-5-8(12)13/h1-2H,3-5H2,(H,11,14)(H,12,13) |
| InChIKey | OQOSERFRGWODNM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.63 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|