C8H8ClNO5 — CID 66165991
3-[(5-chlorofuran-2-carbonyl)amino]-2-hydroxypropanoic acid (PubChem CID 66165991) has the molecular formula C8H8ClNO5 and a molecular weight of 233.61 g/mol. Its IUPAC name is 3-[(5-chlorofuran-2-carbonyl)amino]-2-hydroxypropanoic acid.
| Compound Name | 3-[(5-chlorofuran-2-carbonyl)amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 66165991 |
| Molecular Formula | C8H8ClNO5 |
| Molecular Weight | 233.61 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 3-[(5-chlorofuran-2-carbonyl)amino]-2-hydroxypropanoic acid |
| SMILES | O=C(NCC(O)C(=O)O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C8H8ClNO5/c9-6-2-1-5(15-6)7(12)10-3-4(11)8(13)14/h1-2,4,11H,3H2,(H,10,12)(H,13,14) |
| InChIKey | WSFRAUOYAUVIFT-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.61 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |