C9H11Cl2NO3 — CID 106689982
5-chloro-N-(2-chloro-3-methoxypropyl)furan-2-carboxamide (PubChem CID 106689982) has the molecular formula C9H11Cl2NO3 and a molecular weight of 252.10 g/mol. Its IUPAC name is 5-chloro-N-(2-chloro-3-methoxypropyl)furan-2-carboxamide.
| Compound Name | 5-chloro-N-(2-chloro-3-methoxypropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 106689982 |
| Molecular Formula | C9H11Cl2NO3 |
| Molecular Weight | 252.10 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 5-chloro-N-(2-chloro-3-methoxypropyl)furan-2-carboxamide |
| SMILES | COCC(Cl)CNC(=O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C9H11Cl2NO3/c1-14-5-6(10)4-12-9(13)7-2-3-8(11)15-7/h2-3,6H,4-5H2,1H3,(H,12,13) |
| InChIKey | OAZXGXMFKQSVSO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.10 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|