C13H14ClNO3 — CID 113271992
N-(2-chloro-3-methoxypropyl)-1-benzofuran-2-carboxamide (PubChem CID 113271992) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is N-(2-chloro-3-methoxypropyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(2-chloro-3-methoxypropyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 113271992 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | N-(2-chloro-3-methoxypropyl)-1-benzofuran-2-carboxamide |
| SMILES | COCC(Cl)CNC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C13H14ClNO3/c1-17-8-10(14)7-15-13(16)12-6-9-4-2-3-5-11(9)18-12/h2-6,10H,7-8H2,1H3,(H,15,16) |
| InChIKey | IDALARPGXQLQRF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|