C12H18ClNO3 — CID 114298846
N-(2-chloro-3-methoxypropyl)-2,4,5-trimethylfuran-3-carboxamide (PubChem CID 114298846) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is N-(2-chloro-3-methoxypropyl)-2,4,5-trimethylfuran-3-carboxamide.
| Compound Name | N-(2-chloro-3-methoxypropyl)-2,4,5-trimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 114298846 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(2-chloro-3-methoxypropyl)-2,4,5-trimethylfuran-3-carboxamide |
| SMILES | COCC(Cl)CNC(=O)c1c(C)oc(C)c1C |
| InChI | InChI=1S/C12H18ClNO3/c1-7-8(2)17-9(3)11(7)12(15)14-5-10(13)6-16-4/h10H,5-6H2,1-4H3,(H,14,15) |
| InChIKey | YVANODNGCQGOCB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|