C9H12ClNO2S — CID 114298911
N-(2-chloro-3-methoxypropyl)thiophene-3-carboxamide (PubChem CID 114298911) has the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. Its IUPAC name is N-(2-chloro-3-methoxypropyl)thiophene-3-carboxamide.
| Compound Name | N-(2-chloro-3-methoxypropyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 114298911 |
| Molecular Formula | C9H12ClNO2S |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | N-(2-chloro-3-methoxypropyl)thiophene-3-carboxamide |
| SMILES | COCC(Cl)CNC(=O)c1ccsc1 |
| InChI | InChI=1S/C9H12ClNO2S/c1-13-5-8(10)4-11-9(12)7-2-3-14-6-7/h2-3,6,8H,4-5H2,1H3,(H,11,12) |
| InChIKey | INYKUDJISFQRKO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|