C12H19NO3S — CID 111662690
N-[2-hydroxy-3-(2-methylpropoxy)propyl]thiophene-3-carboxamide (PubChem CID 111662690) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is N-[2-hydroxy-3-(2-methylpropoxy)propyl]thiophene-3-carboxamide.
| Compound Name | N-[2-hydroxy-3-(2-methylpropoxy)propyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 111662690 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-[2-hydroxy-3-(2-methylpropoxy)propyl]thiophene-3-carboxamide |
| SMILES | CC(C)COCC(O)CNC(=O)c1ccsc1 |
| InChI | InChI=1S/C12H19NO3S/c1-9(2)6-16-7-11(14)5-13-12(15)10-3-4-17-8-10/h3-4,8-9,11,14H,5-7H2,1-2H3,(H,13,15) |
| InChIKey | RJCNCMNXQWRTBZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |