C17H23N3O3 — CID 111697672
N-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-pyrazol-1-ylbenzamide (PubChem CID 111697672) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-pyrazol-1-ylbenzamide.
| Compound Name | N-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-pyrazol-1-ylbenzamide |
|---|---|
| PubChem CID | 111697672 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-[2-hydroxy-3-(2-methylpropoxy)propyl]-3-pyrazol-1-ylbenzamide |
| SMILES | CC(C)COCC(O)CNC(=O)c1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C17H23N3O3/c1-13(2)11-23-12-16(21)10-18-17(22)14-5-3-6-15(9-14)20-8-4-7-19-20/h3-9,13,16,21H,10-12H2,1-2H3,(H,18,22) |
| InChIKey | KRKZTZZSJRIZAY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |