C16H22N4O2 — CID 99816184
N-[(2R)-2-hydroxy-4,4-dimethylpentyl]-3-(triazol-1-yl)benzamide (PubChem CID 99816184) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-4,4-dimethylpentyl]-3-(triazol-1-yl)benzamide.
| Compound Name | N-[(2R)-2-hydroxy-4,4-dimethylpentyl]-3-(triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 99816184 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | N-[(2R)-2-hydroxy-4,4-dimethylpentyl]-3-(triazol-1-yl)benzamide |
| SMILES | CC(C)(C)C[C@@H](O)CNC(=O)c1cccc(-n2ccnn2)c1 |
| InChI | InChI=1S/C16H22N4O2/c1-16(2,3)10-14(21)11-17-15(22)12-5-4-6-13(9-12)20-8-7-18-19-20/h4-9,14,21H,10-11H2,1-3H3,(H,17,22)/t14-/m1/s1 |
| InChIKey | QYCGNLUQWVSINV-CQSZACIVSA-N |
| XLogP | 1.79 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |