C16H17N5OS — CID 97243759
N-[(1R)-1-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(triazol-1-yl)benzamide (PubChem CID 97243759) has the molecular formula C16H17N5OS and a molecular weight of 327.41 g/mol. Its IUPAC name is N-[(1R)-1-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(triazol-1-yl)benzamide.
| Compound Name | N-[(1R)-1-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 97243759 |
| Molecular Formula | C16H17N5OS |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-[(1R)-1-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(triazol-1-yl)benzamide |
| SMILES | CC[C@@H](NC(=O)c1cccc(-n2ccnn2)c1)c1ncc(C)s1 |
| InChI | InChI=1S/C16H17N5OS/c1-3-14(16-17-10-11(2)23-16)19-15(22)12-5-4-6-13(9-12)21-8-7-18-20-21/h4-10,14H,3H2,1-2H3,(H,19,22)/t14-/m1/s1 |
| InChIKey | MYZBJTXRTFOZDF-CQSZACIVSA-N |
| XLogP | 2.91 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |