C21H24N6O3 — CID 55902695
N-[1-[2-[2-(dimethylamino)-2-oxoethoxy]phenyl]propyl]-3-(tetrazol-1-yl)benzamide (PubChem CID 55902695) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[1-[2-[2-(dimethylamino)-2-oxoethoxy]phenyl]propyl]-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-[1-[2-[2-(dimethylamino)-2-oxoethoxy]phenyl]propyl]-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 55902695 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-[1-[2-[2-(dimethylamino)-2-oxoethoxy]phenyl]propyl]-3-(tetrazol-1-yl)benzamide |
| SMILES | CCC(NC(=O)c1cccc(-n2cnnn2)c1)c1ccccc1OCC(=O)N(C)C |
| InChI | InChI=1S/C21H24N6O3/c1-4-18(17-10-5-6-11-19(17)30-13-20(28)26(2)3)23-21(29)15-8-7-9-16(12-15)27-14-22-24-25-27/h5-12,14,18H,4,13H2,1-3H3,(H,23,29) |
| InChIKey | WNCVDBQLMFBDCR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |