C19H21ClN6O — CID 110278520
N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-3-(tetrazol-1-yl)benzamide (PubChem CID 110278520) has the molecular formula C19H21ClN6O and a molecular weight of 384.87 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 110278520 |
| Molecular Formula | C19H21ClN6O |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-3-(tetrazol-1-yl)benzamide |
| SMILES | CN(C)CCC(NC(=O)c1cccc(-n2cnnn2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN6O/c1-25(2)11-10-18(14-6-8-16(20)9-7-14)22-19(27)15-4-3-5-17(12-15)26-13-21-23-24-26/h3-9,12-13,18H,10-11H2,1-2H3,(H,22,27) |
| InChIKey | CBIFCVOWNQAIRE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |