C22H21N5OS — CID 30406600
N-[(S)-(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]-3-(tetrazol-1-yl)benzamide (PubChem CID 30406600) has the molecular formula C22H21N5OS and a molecular weight of 403.51 g/mol. Its IUPAC name is N-[(S)-(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(S)-(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 30406600 |
| Molecular Formula | C22H21N5OS |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-[(S)-(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]-3-(tetrazol-1-yl)benzamide |
| SMILES | CC(C)c1ccc([C@H](NC(=O)c2cccc(-n3cnnn3)c2)c2cccs2)cc1 |
| InChI | InChI=1S/C22H21N5OS/c1-15(2)16-8-10-17(11-9-16)21(20-7-4-12-29-20)24-22(28)18-5-3-6-19(13-18)27-14-23-25-26-27/h3-15,21H,1-2H3,(H,24,28)/t21-/m0/s1 |
| InChIKey | VSKLUXXYDXGOBT-NRFANRHFSA-N |
| XLogP | 4.37 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |