C20H24N6OS — CID 51969392
N-[(2R)-2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-(tetrazol-1-yl)benzamide (PubChem CID 51969392) has the molecular formula C20H24N6OS and a molecular weight of 396.52 g/mol. Its IUPAC name is N-[(2R)-2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(2R)-2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 51969392 |
| Molecular Formula | C20H24N6OS |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-[(2R)-2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-(tetrazol-1-yl)benzamide |
| SMILES | CC1CCN([C@H](CNC(=O)c2cccc(-n3cnnn3)c2)c2cccs2)CC1 |
| InChI | InChI=1S/C20H24N6OS/c1-15-7-9-25(10-8-15)18(19-6-3-11-28-19)13-21-20(27)16-4-2-5-17(12-16)26-14-22-23-24-26/h2-6,11-12,14-15,18H,7-10,13H2,1H3,(H,21,27)/t18-/m1/s1 |
| InChIKey | BWUPVXYQUOUQQX-GOSISDBHSA-N |
| XLogP | 2.93 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |