C21H24N6O3 — CID 25495794
N-[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-3-(tetrazol-1-yl)benzamide (PubChem CID 25495794) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 25495794 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-3-(tetrazol-1-yl)benzamide |
| SMILES | COc1ccc([C@@H](CNC(=O)c2cccc(-n3cnnn3)c2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H24N6O3/c1-29-19-7-5-16(6-8-19)20(26-9-11-30-12-10-26)14-22-21(28)17-3-2-4-18(13-17)27-15-23-24-25-27/h2-8,13,15,20H,9-12,14H2,1H3,(H,22,28)/t20-/m1/s1 |
| InChIKey | DUZCHTSDIXGGFJ-HXUWFJFHSA-N |
| XLogP | 1.47 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |