C19H22ClN3O3S — CID 8781620
4-chloro-N-[(2S)-2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-nitrobenzamide (PubChem CID 8781620) has the molecular formula C19H22ClN3O3S and a molecular weight of 407.92 g/mol. Its IUPAC name is 4-chloro-N-[(2S)-2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[(2S)-2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 8781620 |
| Molecular Formula | C19H22ClN3O3S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 4-chloro-N-[(2S)-2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-nitrobenzamide |
| SMILES | CC1CCN([C@@H](CNC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c2cccs2)CC1 |
| InChI | InChI=1S/C19H22ClN3O3S/c1-13-6-8-22(9-7-13)17(18-3-2-10-27-18)12-21-19(24)14-4-5-15(20)16(11-14)23(25)26/h2-5,10-11,13,17H,6-9,12H2,1H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | SHZKCJCKBUZVGD-KRWDZBQOSA-N |
| XLogP | 4.51 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|