C19H22ClFN2OS — CID 43006400
2-chloro-4-fluoro-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]benzamide (PubChem CID 43006400) has the molecular formula C19H22ClFN2OS and a molecular weight of 380.92 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]benzamide.
| Compound Name | 2-chloro-4-fluoro-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 43006400 |
| Molecular Formula | C19H22ClFN2OS |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 2-chloro-4-fluoro-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]benzamide |
| SMILES | CC1CCN(C(CNC(=O)c2ccc(F)cc2Cl)c2cccs2)CC1 |
| InChI | InChI=1S/C19H22ClFN2OS/c1-13-6-8-23(9-7-13)17(18-3-2-10-25-18)12-22-19(24)15-5-4-14(21)11-16(15)20/h2-5,10-11,13,17H,6-9,12H2,1H3,(H,22,24) |
| InChIKey | XKZIACBTJAQICD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |