C19H27Cl2N3OS — CID 119946151
2-amino-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]benzamide;dihydrochloride (PubChem CID 119946151) has the molecular formula C19H27Cl2N3OS and a molecular weight of 416.42 g/mol. Its IUPAC name is 2-amino-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]benzamide;dihydrochloride.
| Compound Name | 2-amino-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119946151 |
| Molecular Formula | C19H27Cl2N3OS |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-amino-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]benzamide;dihydrochloride |
| SMILES | CC1CCN(C(CNC(=O)c2ccccc2N)c2cccs2)CC1.Cl.Cl |
| InChI | InChI=1S/C19H25N3OS.2ClH/c1-14-8-10-22(11-9-14)17(18-7-4-12-24-18)13-21-19(23)15-5-2-3-6-16(15)20;;/h2-7,12,14,17H,8-11,13,20H2,1H3,(H,21,23);2*1H |
| InChIKey | NIGANSJJSPOFAK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|