C20H27N3O3S2 — CID 24639911
2-methyl-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-5-sulfamoylbenzamide (PubChem CID 24639911) has the molecular formula C20H27N3O3S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 2-methyl-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-5-sulfamoylbenzamide.
| Compound Name | 2-methyl-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 24639911 |
| Molecular Formula | C20H27N3O3S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 2-methyl-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-5-sulfamoylbenzamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)NCC(c1cccs1)N1CCC(C)CC1 |
| InChI | InChI=1S/C20H27N3O3S2/c1-14-7-9-23(10-8-14)18(19-4-3-11-27-19)13-22-20(24)17-12-16(28(21,25)26)6-5-15(17)2/h3-6,11-12,14,18H,7-10,13H2,1-2H3,(H,22,24)(H2,21,25,26) |
| InChIKey | MHXLLMBSYKHDRL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |