C17H23Cl2N3OS — CID 119946170
2-amino-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide;dihydrochloride (PubChem CID 119946170) has the molecular formula C17H23Cl2N3OS and a molecular weight of 388.36 g/mol. Its IUPAC name is 2-amino-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide;dihydrochloride.
| Compound Name | 2-amino-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119946170 |
| Molecular Formula | C17H23Cl2N3OS |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-amino-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1C(=O)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C17H21N3OS.2ClH/c18-14-7-2-1-6-13(14)17(21)19-12-15(16-8-5-11-22-16)20-9-3-4-10-20;;/h1-2,5-8,11,15H,3-4,9-10,12,18H2,(H,19,21);2*1H |
| InChIKey | DXTDHMTWVZHWHH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|