C15H19N5OS — CID 42940363
3-amino-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)pyrazine-2-carboxamide (PubChem CID 42940363) has the molecular formula C15H19N5OS and a molecular weight of 317.42 g/mol. Its IUPAC name is 3-amino-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 42940363 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 3-amino-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)pyrazine-2-carboxamide |
| SMILES | Nc1nccnc1C(=O)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C15H19N5OS/c16-14-13(17-5-6-18-14)15(21)19-10-11(12-4-3-9-22-12)20-7-1-2-8-20/h3-6,9,11H,1-2,7-8,10H2,(H2,16,18)(H,19,21) |
| InChIKey | VHHZMDJCTROOLI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |