C15H21N5O2 — CID 109481241
N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-3-(triazol-1-yl)benzamide (PubChem CID 109481241) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-3-(triazol-1-yl)benzamide.
| Compound Name | N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-3-(triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 109481241 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-3-(triazol-1-yl)benzamide |
| SMILES | CN(C)CC(C)(O)CNC(=O)c1cccc(-n2ccnn2)c1 |
| InChI | InChI=1S/C15H21N5O2/c1-15(22,11-19(2)3)10-16-14(21)12-5-4-6-13(9-12)20-8-7-17-18-20/h4-9,22H,10-11H2,1-3H3,(H,16,21) |
| InChIKey | ZYYNYJIEGDAWFI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |