C18H19N3O2S — CID 70769503
N-[2-(hydroxymethyl)-3-thiophen-3-ylpropyl]-3-pyrazol-1-ylbenzamide (PubChem CID 70769503) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is N-[2-(hydroxymethyl)-3-thiophen-3-ylpropyl]-3-pyrazol-1-ylbenzamide.
| Compound Name | N-[2-(hydroxymethyl)-3-thiophen-3-ylpropyl]-3-pyrazol-1-ylbenzamide |
|---|---|
| PubChem CID | 70769503 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[2-(hydroxymethyl)-3-thiophen-3-ylpropyl]-3-pyrazol-1-ylbenzamide |
| SMILES | O=C(NCC(CO)Cc1ccsc1)c1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C18H19N3O2S/c22-12-15(9-14-5-8-24-13-14)11-19-18(23)16-3-1-4-17(10-16)21-7-2-6-20-21/h1-8,10,13,15,22H,9,11-12H2,(H,19,23) |
| InChIKey | RNVDUBNJGKNPKM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |