C17H14N6OS — CID 122275883
3-pyrazol-1-yl-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzamide (PubChem CID 122275883) has the molecular formula C17H14N6OS and a molecular weight of 350.41 g/mol. Its IUPAC name is 3-pyrazol-1-yl-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzamide.
| Compound Name | 3-pyrazol-1-yl-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 122275883 |
| Molecular Formula | C17H14N6OS |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 3-pyrazol-1-yl-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzamide |
| SMILES | O=C(NCc1cn(-c2ccsc2)nn1)c1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C17H14N6OS/c24-17(13-3-1-4-15(9-13)22-7-2-6-19-22)18-10-14-11-23(21-20-14)16-5-8-25-12-16/h1-9,11-12H,10H2,(H,18,24) |
| InChIKey | PIZKPKLQGUXMLQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |