C14H11F2N5OS — CID 122275994
1-(2,6-difluorophenyl)-3-[(1-thiophen-3-yltriazol-4-yl)methyl]urea (PubChem CID 122275994) has the molecular formula C14H11F2N5OS and a molecular weight of 335.34 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[(1-thiophen-3-yltriazol-4-yl)methyl]urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[(1-thiophen-3-yltriazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 122275994 |
| Molecular Formula | C14H11F2N5OS |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[(1-thiophen-3-yltriazol-4-yl)methyl]urea |
| SMILES | O=C(NCc1cn(-c2ccsc2)nn1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C14H11F2N5OS/c15-11-2-1-3-12(16)13(11)18-14(22)17-6-9-7-21(20-19-9)10-4-5-23-8-10/h1-5,7-8H,6H2,(H2,17,18,22) |
| InChIKey | SXVBOJKLXWOWKM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |