C14H14N6OS — CID 122275949
1-(4-methyl-3-pyridinyl)-3-[(1-thiophen-3-yltriazol-4-yl)methyl]urea (PubChem CID 122275949) has the molecular formula C14H14N6OS and a molecular weight of 314.37 g/mol. Its IUPAC name is 1-(4-methyl-3-pyridinyl)-3-[(1-thiophen-3-yltriazol-4-yl)methyl]urea.
| Compound Name | 1-(4-methyl-3-pyridinyl)-3-[(1-thiophen-3-yltriazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 122275949 |
| Molecular Formula | C14H14N6OS |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-(4-methyl-3-pyridinyl)-3-[(1-thiophen-3-yltriazol-4-yl)methyl]urea |
| SMILES | Cc1ccncc1NC(=O)NCc1cn(-c2ccsc2)nn1 |
| InChI | InChI=1S/C14H14N6OS/c1-10-2-4-15-7-13(10)17-14(21)16-6-11-8-20(19-18-11)12-3-5-22-9-12/h2-5,7-9H,6H2,1H3,(H2,16,17,21) |
| InChIKey | CNHLIOLXZKYOQN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |