C14H13N7O — CID 121198111
1-pyridin-3-yl-3-[(1-pyridin-3-yltriazol-4-yl)methyl]urea (PubChem CID 121198111) has the molecular formula C14H13N7O and a molecular weight of 295.31 g/mol. Its IUPAC name is 1-pyridin-3-yl-3-[(1-pyridin-3-yltriazol-4-yl)methyl]urea.
| Compound Name | 1-pyridin-3-yl-3-[(1-pyridin-3-yltriazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 121198111 |
| Molecular Formula | C14H13N7O |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-pyridin-3-yl-3-[(1-pyridin-3-yltriazol-4-yl)methyl]urea |
| SMILES | O=C(NCc1cn(-c2cccnc2)nn1)Nc1cccnc1 |
| InChI | InChI=1S/C14H13N7O/c22-14(18-11-3-1-5-15-7-11)17-8-12-10-21(20-19-12)13-4-2-6-16-9-13/h1-7,9-10H,8H2,(H2,17,18,22) |
| InChIKey | OCXBWTPZFALRAN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |