C17H11F6N5O — CID 121198065
N-[(1-pyridin-3-yltriazol-4-yl)methyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 121198065) has the molecular formula C17H11F6N5O and a molecular weight of 415.30 g/mol. Its IUPAC name is N-[(1-pyridin-3-yltriazol-4-yl)methyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(1-pyridin-3-yltriazol-4-yl)methyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 121198065 |
| Molecular Formula | C17H11F6N5O |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[(1-pyridin-3-yltriazol-4-yl)methyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NCc1cn(-c2cccnc2)nn1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H11F6N5O/c18-16(19,20)11-4-10(5-12(6-11)17(21,22)23)15(29)25-7-13-9-28(27-26-13)14-2-1-3-24-8-14/h1-6,8-9H,7H2,(H,25,29) |
| InChIKey | KDAOYOHTCNNAFE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |