C16H13N7O2 — CID 121198009
5-(furan-2-yl)-N-[(1-pyridin-3-yltriazol-4-yl)methyl]-1H-pyrazole-3-carboxamide (PubChem CID 121198009) has the molecular formula C16H13N7O2 and a molecular weight of 335.33 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-[(1-pyridin-3-yltriazol-4-yl)methyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-[(1-pyridin-3-yltriazol-4-yl)methyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 121198009 |
| Molecular Formula | C16H13N7O2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 5-(furan-2-yl)-N-[(1-pyridin-3-yltriazol-4-yl)methyl]-1H-pyrazole-3-carboxamide |
| SMILES | O=C(NCc1cn(-c2cccnc2)nn1)c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C16H13N7O2/c24-16(14-7-13(20-21-14)15-4-2-6-25-15)18-8-11-10-23(22-19-11)12-3-1-5-17-9-12/h1-7,9-10H,8H2,(H,18,24)(H,20,21) |
| InChIKey | HCJHWEZUAWATET-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 114.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |