C14H15N5O2 — CID 19513881
N-[(1-ethylpyrazol-4-yl)methyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide (PubChem CID 19513881) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is N-[(1-ethylpyrazol-4-yl)methyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(1-ethylpyrazol-4-yl)methyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19513881 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-[(1-ethylpyrazol-4-yl)methyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide |
| SMILES | CCn1cc(CNC(=O)c2cc(-c3ccco3)[nH]n2)cn1 |
| InChI | InChI=1S/C14H15N5O2/c1-2-19-9-10(8-16-19)7-15-14(20)12-6-11(17-18-12)13-4-3-5-21-13/h3-6,8-9H,2,7H2,1H3,(H,15,20)(H,17,18) |
| InChIKey | QLDIFZCDWVLBJB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |