C16H15N3O3 — CID 110908938
5-(furan-2-yl)-N-[[2-(hydroxymethyl)phenyl]methyl]-1H-pyrazole-3-carboxamide (PubChem CID 110908938) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-[[2-(hydroxymethyl)phenyl]methyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-[[2-(hydroxymethyl)phenyl]methyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110908938 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 5-(furan-2-yl)-N-[[2-(hydroxymethyl)phenyl]methyl]-1H-pyrazole-3-carboxamide |
| SMILES | O=C(NCc1ccccc1CO)c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C16H15N3O3/c20-10-12-5-2-1-4-11(12)9-17-16(21)14-8-13(18-19-14)15-6-3-7-22-15/h1-8,20H,9-10H2,(H,17,21)(H,18,19) |
| InChIKey | CTJQQTQRWWCVTA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |