C17H17N7O2 — CID 19514082
N-[1-[(1-ethylpyrazol-4-yl)methyl]pyrazol-4-yl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide (PubChem CID 19514082) has the molecular formula C17H17N7O2 and a molecular weight of 351.37 g/mol. Its IUPAC name is N-[1-[(1-ethylpyrazol-4-yl)methyl]pyrazol-4-yl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[1-[(1-ethylpyrazol-4-yl)methyl]pyrazol-4-yl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19514082 |
| Molecular Formula | C17H17N7O2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-[1-[(1-ethylpyrazol-4-yl)methyl]pyrazol-4-yl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide |
| SMILES | CCn1cc(Cn2cc(NC(=O)c3cc(-c4ccco4)[nH]n3)cn2)cn1 |
| InChI | InChI=1S/C17H17N7O2/c1-2-23-9-12(7-18-23)10-24-11-13(8-19-24)20-17(25)15-6-14(21-22-15)16-4-3-5-26-16/h3-9,11H,2,10H2,1H3,(H,20,25)(H,21,22) |
| InChIKey | FGQHDHBBUBIFKC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |