C18H21N5OS — CID 122275968
1-(4-tert-butylphenyl)-3-[(1-thiophen-3-yltriazol-4-yl)methyl]urea (PubChem CID 122275968) has the molecular formula C18H21N5OS and a molecular weight of 355.47 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[(1-thiophen-3-yltriazol-4-yl)methyl]urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[(1-thiophen-3-yltriazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 122275968 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[(1-thiophen-3-yltriazol-4-yl)methyl]urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)NCc2cn(-c3ccsc3)nn2)cc1 |
| InChI | InChI=1S/C18H21N5OS/c1-18(2,3)13-4-6-14(7-5-13)20-17(24)19-10-15-11-23(22-21-15)16-8-9-25-12-16/h4-9,11-12H,10H2,1-3H3,(H2,19,20,24) |
| InChIKey | UBCCCFFPHYHHNP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |