C14H11FN4OS — CID 122275801
3-fluoro-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzamide (PubChem CID 122275801) has the molecular formula C14H11FN4OS and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-fluoro-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzamide.
| Compound Name | 3-fluoro-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 122275801 |
| Molecular Formula | C14H11FN4OS |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 3-fluoro-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzamide |
| SMILES | O=C(NCc1cn(-c2ccsc2)nn1)c1cccc(F)c1 |
| InChI | InChI=1S/C14H11FN4OS/c15-11-3-1-2-10(6-11)14(20)16-7-12-8-19(18-17-12)13-4-5-21-9-13/h1-6,8-9H,7H2,(H,16,20) |
| InChIKey | GMTOAVVMJTVCEC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |