C19H15N5OS — CID 121195848
N-[(1-pyridin-4-yltriazol-4-yl)methyl]-4-thiophen-3-ylbenzamide (PubChem CID 121195848) has the molecular formula C19H15N5OS and a molecular weight of 361.43 g/mol. Its IUPAC name is N-[(1-pyridin-4-yltriazol-4-yl)methyl]-4-thiophen-3-ylbenzamide.
| Compound Name | N-[(1-pyridin-4-yltriazol-4-yl)methyl]-4-thiophen-3-ylbenzamide |
|---|---|
| PubChem CID | 121195848 |
| Molecular Formula | C19H15N5OS |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-[(1-pyridin-4-yltriazol-4-yl)methyl]-4-thiophen-3-ylbenzamide |
| SMILES | O=C(NCc1cn(-c2ccncc2)nn1)c1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C19H15N5OS/c25-19(15-3-1-14(2-4-15)16-7-10-26-13-16)21-11-17-12-24(23-22-17)18-5-8-20-9-6-18/h1-10,12-13H,11H2,(H,21,25) |
| InChIKey | DFJMYBJGOVVZNL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |