C22H19N5O — CID 121195878
2,2-diphenyl-N-[(1-pyridin-4-yltriazol-4-yl)methyl]acetamide (PubChem CID 121195878) has the molecular formula C22H19N5O and a molecular weight of 369.43 g/mol. Its IUPAC name is 2,2-diphenyl-N-[(1-pyridin-4-yltriazol-4-yl)methyl]acetamide.
| Compound Name | 2,2-diphenyl-N-[(1-pyridin-4-yltriazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 121195878 |
| Molecular Formula | C22H19N5O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2,2-diphenyl-N-[(1-pyridin-4-yltriazol-4-yl)methyl]acetamide |
| SMILES | O=C(NCc1cn(-c2ccncc2)nn1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19N5O/c28-22(21(17-7-3-1-4-8-17)18-9-5-2-6-10-18)24-15-19-16-27(26-25-19)20-11-13-23-14-12-20/h1-14,16,21H,15H2,(H,24,28) |
| InChIKey | WMAQYMVRUUTFEO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |