C18H14N6O — CID 121195947
N-[(1-pyridin-4-yltriazol-4-yl)methyl]quinoline-2-carboxamide (PubChem CID 121195947) has the molecular formula C18H14N6O and a molecular weight of 330.35 g/mol. Its IUPAC name is N-[(1-pyridin-4-yltriazol-4-yl)methyl]quinoline-2-carboxamide.
| Compound Name | N-[(1-pyridin-4-yltriazol-4-yl)methyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 121195947 |
| Molecular Formula | C18H14N6O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[(1-pyridin-4-yltriazol-4-yl)methyl]quinoline-2-carboxamide |
| SMILES | O=C(NCc1cn(-c2ccncc2)nn1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H14N6O/c25-18(17-6-5-13-3-1-2-4-16(13)21-17)20-11-14-12-24(23-22-14)15-7-9-19-10-8-15/h1-10,12H,11H2,(H,20,25) |
| InChIKey | UXBFKUKQQPCNEL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |