C12H10N4OS2 — CID 122162192
N-[(1-thiophen-3-yltriazol-4-yl)methyl]thiophene-2-carboxamide (PubChem CID 122162192) has the molecular formula C12H10N4OS2 and a molecular weight of 290.37 g/mol. Its IUPAC name is N-[(1-thiophen-3-yltriazol-4-yl)methyl]thiophene-2-carboxamide.
| Compound Name | N-[(1-thiophen-3-yltriazol-4-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 122162192 |
| Molecular Formula | C12H10N4OS2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | N-[(1-thiophen-3-yltriazol-4-yl)methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1cn(-c2ccsc2)nn1)c1cccs1 |
| InChI | InChI=1S/C12H10N4OS2/c17-12(11-2-1-4-19-11)13-6-9-7-16(15-14-9)10-3-5-18-8-10/h1-5,7-8H,6H2,(H,13,17) |
| InChIKey | LSHFSQXHSHWPCK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |