C14H10ClFN4OS — CID 122162202
2-chloro-4-fluoro-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzamide (PubChem CID 122162202) has the molecular formula C14H10ClFN4OS and a molecular weight of 336.78 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzamide.
| Compound Name | 2-chloro-4-fluoro-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 122162202 |
| Molecular Formula | C14H10ClFN4OS |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 2-chloro-4-fluoro-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzamide |
| SMILES | O=C(NCc1cn(-c2ccsc2)nn1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H10ClFN4OS/c15-13-5-9(16)1-2-12(13)14(21)17-6-10-7-20(19-18-10)11-3-4-22-8-11/h1-5,7-8H,6H2,(H,17,21) |
| InChIKey | QSMXBRLEBNPSPU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |