C13H11ClN4O2S2 — CID 122276027
2-chloro-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzenesulfonamide (PubChem CID 122276027) has the molecular formula C13H11ClN4O2S2 and a molecular weight of 354.84 g/mol. Its IUPAC name is 2-chloro-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122276027 |
| Molecular Formula | C13H11ClN4O2S2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 2-chloro-N-[(1-thiophen-3-yltriazol-4-yl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cn(-c2ccsc2)nn1)c1ccccc1Cl |
| InChI | InChI=1S/C13H11ClN4O2S2/c14-12-3-1-2-4-13(12)22(19,20)15-7-10-8-18(17-16-10)11-5-6-21-9-11/h1-6,8-9,15H,7H2 |
| InChIKey | UBIVAOBAQCELEM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |